C29H32FN3O2 — CID 42817561
N-[[5-(cyclobutanecarbonylamino)-2-(dimethylamino)phenyl]methyl]-N-[(3-fluorophenyl)methyl]-3-methylbenzamide (PubChem CID 42817561) has the molecular formula C29H32FN3O2 and a molecular weight of 473.59 g/mol. Its IUPAC name is N-[[5-(cyclobutanecarbonylamino)-2-(dimethylamino)phenyl]methyl]-N-[(3-fluorophenyl)methyl]-3-methylbenzamide.
| Compound Name | N-[[5-(cyclobutanecarbonylamino)-2-(dimethylamino)phenyl]methyl]-N-[(3-fluorophenyl)methyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 42817561 |
| Molecular Formula | C29H32FN3O2 |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | N-[[5-(cyclobutanecarbonylamino)-2-(dimethylamino)phenyl]methyl]-N-[(3-fluorophenyl)methyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)N(Cc2cccc(F)c2)Cc2cc(NC(=O)C3CCC3)ccc2N(C)C)c1 |
| InChI | InChI=1S/C29H32FN3O2/c1-20-7-4-11-23(15-20)29(35)33(18-21-8-5-12-25(30)16-21)19-24-17-26(13-14-27(24)32(2)3)31-28(34)22-9-6-10-22/h4-5,7-8,11-17,22H,6,9-10,18-19H2,1-3H3,(H,31,34) |
| InChIKey | IKUMMMUNYPQCKY-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|