C19H25N3O3 — CID 42821142
ethyl 1,3,5-trimethyl-4-[2-(2-pyridin-2-ylethylamino)acetyl]pyrrole-2-carboxylate (PubChem CID 42821142) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is ethyl 1,3,5-trimethyl-4-[2-(2-pyridin-2-ylethylamino)acetyl]pyrrole-2-carboxylate.
| Compound Name | ethyl 1,3,5-trimethyl-4-[2-(2-pyridin-2-ylethylamino)acetyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 42821142 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | ethyl 1,3,5-trimethyl-4-[2-(2-pyridin-2-ylethylamino)acetyl]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(C)c(C(=O)CNCCc2ccccn2)c(C)n1C |
| InChI | InChI=1S/C19H25N3O3/c1-5-25-19(24)18-13(2)17(14(3)22(18)4)16(23)12-20-11-9-15-8-6-7-10-21-15/h6-8,10,20H,5,9,11-12H2,1-4H3 |
| InChIKey | UUPZBVZSLQTXMV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|