ethyl 1,4-dimethyl-7-(pyridin-2-ylmethoxy)indole-2-carboxylate

C19H20N2O3 — CID 21194412

IUPACethyl 1,4-dimethyl-7-(pyridin-2-ylmethoxy)indole-2-carboxylate
SMILESCCOC(=O)c1cc2c(C)ccc(OCc3ccccn3)c2n1C
InChIInChI=1S/C19H20N2O3/c1-4-23-19(22)16-11-15-13(2)8-9-17(18(15)21(16)3)24-12-14-7-5-6-10-20-14/h5-11H,4,12H2,1-3H3
InChIKeyKFIXQDFBXCFEQY-UHFFFAOYSA-N
MW324.38 g/mol
LogP3.64
Rot. Bonds5

About ethyl 1,4-dimethyl-7-(pyridin-2-ylmethoxy)indole-2-carboxylate

ethyl 1,4-dimethyl-7-(pyridin-2-ylmethoxy)indole-2-carboxylate (PubChem CID 21194412) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is ethyl 1,4-dimethyl-7-(pyridin-2-ylmethoxy)indole-2-carboxylate.

Molecular Properties

Compound Nameethyl 1,4-dimethyl-7-(pyridin-2-ylmethoxy)indole-2-carboxylate
PubChem CID21194412
Molecular FormulaC19H20N2O3
Molecular Weight324.38 g/mol
Exact Mass324.15
IUPAC Nameethyl 1,4-dimethyl-7-(pyridin-2-ylmethoxy)indole-2-carboxylate
SMILESCCOC(=O)c1cc2c(C)ccc(OCc3ccccn3)c2n1C
InChIInChI=1S/C19H20N2O3/c1-4-23-19(22)16-11-15-13(2)8-9-17(18(15)21(16)3)24-12-14-7-5-6-10-20-14/h5-11H,4,12H2,1-3H3
InChIKeyKFIXQDFBXCFEQY-UHFFFAOYSA-N
XLogP3.64
TPSA53.35 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500324.38
LogP ≤ 53.64
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze ethyl 1,4-dimethyl-7-(pyridin-2-ylmethoxy)indole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 1,4-dimethyl-7-(pyridin-2-ylmethoxy)indole-2-carboxylate?
The IUPAC name of ethyl 1,4-dimethyl-7-(pyridin-2-ylmethoxy)indole-2-carboxylate (CID 21194412) is ethyl 1,4-dimethyl-7-(pyridin-2-ylmethoxy)indole-2-carboxylate.
What is the SMILES notation for ethyl 1,4-dimethyl-7-(pyridin-2-ylmethoxy)indole-2-carboxylate?
The canonical SMILES for ethyl 1,4-dimethyl-7-(pyridin-2-ylmethoxy)indole-2-carboxylate is CCOC(=O)c1cc2c(C)ccc(OCc3ccccn3)c2n1C.
What is the InChIKey of ethyl 1,4-dimethyl-7-(pyridin-2-ylmethoxy)indole-2-carboxylate?
The InChIKey is KFIXQDFBXCFEQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O3/c1-4-23-19(22)16-11-15-13(2)8-9-17(18(15)21(16)3)24-12-14-7-5-6-10-20-14/h5-11H,4,12H2,1-3H3.
What are the key properties of ethyl 1,4-dimethyl-7-(pyridin-2-ylmethoxy)indole-2-carboxylate?
ethyl 1,4-dimethyl-7-(pyridin-2-ylmethoxy)indole-2-carboxylate has a molecular weight of 324.38 g/mol, XLogP of 3.64, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1,4-dimethyl-7-(pyridin-2-ylmethoxy)indole-2-carboxylate is sourced from PubChem (CID 21194412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).