C28H35NO7 — CID 174244631
ethyl 4-formyl-7-phenylmethoxy-1-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]indole-2-carboxylate (PubChem CID 174244631) has the molecular formula C28H35NO7 and a molecular weight of 497.59 g/mol. Its IUPAC name is ethyl 4-formyl-7-phenylmethoxy-1-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]indole-2-carboxylate.
| Compound Name | ethyl 4-formyl-7-phenylmethoxy-1-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]indole-2-carboxylate |
|---|---|
| PubChem CID | 174244631 |
| Molecular Formula | C28H35NO7 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | ethyl 4-formyl-7-phenylmethoxy-1-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]indole-2-carboxylate |
| SMILES | CCCOCCOCCOCCn1c(C(=O)OCC)cc2c(C=O)ccc(OCc3ccccc3)c21 |
| InChI | InChI=1S/C28H35NO7/c1-3-13-32-15-17-34-18-16-33-14-12-29-25(28(31)35-4-2)19-24-23(20-30)10-11-26(27(24)29)36-21-22-8-6-5-7-9-22/h5-11,19-20H,3-4,12-18,21H2,1-2H3 |
| InChIKey | GIKGLFWCBPXGKX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 85.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|