C20H27ClN2O5 — CID 21194467
ethyl 4-chloro-1-methyl-7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]indole-2-carboxylate (PubChem CID 21194467) has the molecular formula C20H27ClN2O5 and a molecular weight of 410.90 g/mol. Its IUPAC name is ethyl 4-chloro-1-methyl-7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]indole-2-carboxylate.
| Compound Name | ethyl 4-chloro-1-methyl-7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]indole-2-carboxylate |
|---|---|
| PubChem CID | 21194467 |
| Molecular Formula | C20H27ClN2O5 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | ethyl 4-chloro-1-methyl-7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(Cl)ccc(OCCCNC(=O)OC(C)(C)C)c2n1C |
| InChI | InChI=1S/C20H27ClN2O5/c1-6-26-18(24)15-12-13-14(21)8-9-16(17(13)23(15)5)27-11-7-10-22-19(25)28-20(2,3)4/h8-9,12H,6-7,10-11H2,1-5H3,(H,22,25) |
| InChIKey | LEVAAPMYHBTNJI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|