C25H29F3N4O3 — CID 42838538
1-[4-[3-(2-methylpropoxy)-5-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]anilino]-3-prop-2-enoxypropan-2-ol (PubChem CID 42838538) has the molecular formula C25H29F3N4O3 and a molecular weight of 490.53 g/mol. Its IUPAC name is 1-[4-[3-(2-methylpropoxy)-5-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]anilino]-3-prop-2-enoxypropan-2-ol.
| Compound Name | 1-[4-[3-(2-methylpropoxy)-5-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]anilino]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 42838538 |
| Molecular Formula | C25H29F3N4O3 |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 1-[4-[3-(2-methylpropoxy)-5-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]anilino]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOCC(O)CNc1ccc(-n2nc(OCC(C)C)nc2-c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C25H29F3N4O3/c1-4-12-34-16-22(33)14-29-20-8-10-21(11-9-20)32-23(30-24(31-32)35-15-17(2)3)18-6-5-7-19(13-18)25(26,27)28/h4-11,13,17,22,29,33H,1,12,14-16H2,2-3H3 |
| InChIKey | AWXCJZMBKVYEEU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|