C23H24F2N2O3 — CID 42838667
1-[[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-[(3-fluorophenyl)methyl]amino]-3-prop-2-ynoxypropan-2-ol (PubChem CID 42838667) has the molecular formula C23H24F2N2O3 and a molecular weight of 414.45 g/mol. Its IUPAC name is 1-[[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-[(3-fluorophenyl)methyl]amino]-3-prop-2-ynoxypropan-2-ol.
| Compound Name | 1-[[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-[(3-fluorophenyl)methyl]amino]-3-prop-2-ynoxypropan-2-ol |
|---|---|
| PubChem CID | 42838667 |
| Molecular Formula | C23H24F2N2O3 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 1-[[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-[(3-fluorophenyl)methyl]amino]-3-prop-2-ynoxypropan-2-ol |
| SMILES | C#CCOCC(O)CN(Cc1cccc(F)c1)CC1CC(c2ccc(F)cc2)=NO1 |
| InChI | InChI=1S/C23H24F2N2O3/c1-2-10-29-16-21(28)14-27(13-17-4-3-5-20(25)11-17)15-22-12-23(26-30-22)18-6-8-19(24)9-7-18/h1,3-9,11,21-22,28H,10,12-16H2 |
| InChIKey | NORXPDUEFDFKFR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|