C24H26F2N2O3 — CID 46014221
1-[(2,4-difluorophenyl)methyl-[[3-(2-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]amino]-3-prop-2-ynoxypropan-2-ol (PubChem CID 46014221) has the molecular formula C24H26F2N2O3 and a molecular weight of 428.48 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl-[[3-(2-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]amino]-3-prop-2-ynoxypropan-2-ol.
| Compound Name | 1-[(2,4-difluorophenyl)methyl-[[3-(2-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]amino]-3-prop-2-ynoxypropan-2-ol |
|---|---|
| PubChem CID | 46014221 |
| Molecular Formula | C24H26F2N2O3 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl-[[3-(2-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]amino]-3-prop-2-ynoxypropan-2-ol |
| SMILES | C#CCOCC(O)CN(Cc1ccc(F)cc1F)CC1CC(c2ccccc2C)=NO1 |
| InChI | InChI=1S/C24H26F2N2O3/c1-3-10-30-16-20(29)14-28(13-18-8-9-19(25)11-23(18)26)15-21-12-24(27-31-21)22-7-5-4-6-17(22)2/h1,4-9,11,20-21,29H,10,12-16H2,2H3 |
| InChIKey | QPOIICIEZIAXKP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|