C7H17NO2 — CID 42848
Ethanol, 2,2'-(propylimino)bis- (PubChem CID 42848) has the molecular formula C7H17NO2 and a molecular weight of 147.22 g/mol. Its IUPAC name is 2-[2-hydroxyethyl(propyl)amino]ethanol.
| Compound Name | Ethanol, 2,2'-(propylimino)bis- |
|---|---|
| PubChem CID | 42848 |
| Molecular Formula | C7H17NO2 |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.13 |
| IUPAC Name | 2-[2-hydroxyethyl(propyl)amino]ethanol |
| SMILES | CCCN(CCO)CCO |
| InChI | InChI=1S/C7H17NO2/c1-2-3-8(4-6-9)5-7-10/h9-10H,2-7H2,1H3 |
| InChIKey | OZICRFXCUVKDRG-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | 62 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |