C16H27N3O3S — CID 42851143
3-[4-(dimethylamino)phenyl]-2-methyl-N-(2-methylpropyl)-1,2-oxazolidine-4-sulfonamide (PubChem CID 42851143) has the molecular formula C16H27N3O3S and a molecular weight of 341.48 g/mol. Its IUPAC name is 3-[4-(dimethylamino)phenyl]-2-methyl-N-(2-methylpropyl)-1,2-oxazolidine-4-sulfonamide.
| Compound Name | 3-[4-(dimethylamino)phenyl]-2-methyl-N-(2-methylpropyl)-1,2-oxazolidine-4-sulfonamide |
|---|---|
| PubChem CID | 42851143 |
| Molecular Formula | C16H27N3O3S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 3-[4-(dimethylamino)phenyl]-2-methyl-N-(2-methylpropyl)-1,2-oxazolidine-4-sulfonamide |
| SMILES | CC(C)CNS(=O)(=O)C1CON(C)C1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C16H27N3O3S/c1-12(2)10-17-23(20,21)15-11-22-19(5)16(15)13-6-8-14(9-7-13)18(3)4/h6-9,12,15-17H,10-11H2,1-5H3 |
| InChIKey | MFNLOOHRBHOBDA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|