C27H36N4O3 — CID 42852963
2-[4-[(3-methylphenyl)methyl-(prop-2-enylcarbamoyl)amino]phenyl]-N-(3-morpholin-4-ylpropyl)acetamide (PubChem CID 42852963) has the molecular formula C27H36N4O3 and a molecular weight of 464.61 g/mol. Its IUPAC name is 2-[4-[(3-methylphenyl)methyl-(prop-2-enylcarbamoyl)amino]phenyl]-N-(3-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-[4-[(3-methylphenyl)methyl-(prop-2-enylcarbamoyl)amino]phenyl]-N-(3-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 42852963 |
| Molecular Formula | C27H36N4O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | 2-[4-[(3-methylphenyl)methyl-(prop-2-enylcarbamoyl)amino]phenyl]-N-(3-morpholin-4-ylpropyl)acetamide |
| SMILES | C=CCNC(=O)N(Cc1cccc(C)c1)c1ccc(CC(=O)NCCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C27H36N4O3/c1-3-12-29-27(33)31(21-24-7-4-6-22(2)19-24)25-10-8-23(9-11-25)20-26(32)28-13-5-14-30-15-17-34-18-16-30/h3-4,6-11,19H,1,5,12-18,20-21H2,2H3,(H,28,32)(H,29,33) |
| InChIKey | IAQQDFSVBSUVDA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|