C30H33N3O5 — CID 46162426
N-benzyl-N-[3-[2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]phenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 46162426) has the molecular formula C30H33N3O5 and a molecular weight of 515.61 g/mol. Its IUPAC name is N-benzyl-N-[3-[2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]phenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-benzyl-N-[3-[2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]phenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 46162426 |
| Molecular Formula | C30H33N3O5 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | N-benzyl-N-[3-[2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]phenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Cc1cccc(N(Cc2ccccc2)C(=O)c2ccc3c(c2)OCO3)c1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C30H33N3O5/c34-29(31-12-5-13-32-14-16-36-17-15-32)19-24-8-4-9-26(18-24)33(21-23-6-2-1-3-7-23)30(35)25-10-11-27-28(20-25)38-22-37-27/h1-4,6-11,18,20H,5,12-17,19,21-22H2,(H,31,34) |
| InChIKey | LHZBAKQCXUDPLF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|