C27H35F3N4O3 — CID 46046898
N-(3-morpholin-4-ylpropyl)-2-[4-[propan-2-ylcarbamoyl-[[4-(trifluoromethyl)phenyl]methyl]amino]phenyl]acetamide (PubChem CID 46046898) has the molecular formula C27H35F3N4O3 and a molecular weight of 520.60 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-2-[4-[propan-2-ylcarbamoyl-[[4-(trifluoromethyl)phenyl]methyl]amino]phenyl]acetamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-2-[4-[propan-2-ylcarbamoyl-[[4-(trifluoromethyl)phenyl]methyl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 46046898 |
| Molecular Formula | C27H35F3N4O3 |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-2-[4-[propan-2-ylcarbamoyl-[[4-(trifluoromethyl)phenyl]methyl]amino]phenyl]acetamide |
| SMILES | CC(C)NC(=O)N(Cc1ccc(C(F)(F)F)cc1)c1ccc(CC(=O)NCCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C27H35F3N4O3/c1-20(2)32-26(36)34(19-22-4-8-23(9-5-22)27(28,29)30)24-10-6-21(7-11-24)18-25(35)31-12-3-13-33-14-16-37-17-15-33/h4-11,20H,3,12-19H2,1-2H3,(H,31,35)(H,32,36) |
| InChIKey | OUBNUQRASRNRBL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|