C20H26N4O2 — CID 42853159
1-(3-methylbutyl)-3-(4-methylphenyl)-7-propan-2-ylpurine-2,6-dione (PubChem CID 42853159) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-(3-methylbutyl)-3-(4-methylphenyl)-7-propan-2-ylpurine-2,6-dione.
| Compound Name | 1-(3-methylbutyl)-3-(4-methylphenyl)-7-propan-2-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 42853159 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 1-(3-methylbutyl)-3-(4-methylphenyl)-7-propan-2-ylpurine-2,6-dione |
| SMILES | Cc1ccc(-n2c(=O)n(CCC(C)C)c(=O)c3c2ncn3C(C)C)cc1 |
| InChI | InChI=1S/C20H26N4O2/c1-13(2)10-11-22-19(25)17-18(21-12-23(17)14(3)4)24(20(22)26)16-8-6-15(5)7-9-16/h6-9,12-14H,10-11H2,1-5H3 |
| InChIKey | JZZWKYRIBWOSIL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |