C16H14F2N2O3 — CID 42853556
1-(3,4-difluorophenyl)-N-(furan-2-ylmethyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 42853556) has the molecular formula C16H14F2N2O3 and a molecular weight of 320.30 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-N-(furan-2-ylmethyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(3,4-difluorophenyl)-N-(furan-2-ylmethyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42853556 |
| Molecular Formula | C16H14F2N2O3 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 1-(3,4-difluorophenyl)-N-(furan-2-ylmethyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCc1ccco1)C1CCN(c2ccc(F)c(F)c2)C1=O |
| InChI | InChI=1S/C16H14F2N2O3/c17-13-4-3-10(8-14(13)18)20-6-5-12(16(20)22)15(21)19-9-11-2-1-7-23-11/h1-4,7-8,12H,5-6,9H2,(H,19,21) |
| InChIKey | AIECHAHUPDZXAM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|