C16H15F2N3O2 — CID 124885270
(3R)-N-(1-cyanocyclobutyl)-1-(3,4-difluorophenyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 124885270) has the molecular formula C16H15F2N3O2 and a molecular weight of 319.31 g/mol. Its IUPAC name is (3R)-N-(1-cyanocyclobutyl)-1-(3,4-difluorophenyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-(1-cyanocyclobutyl)-1-(3,4-difluorophenyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 124885270 |
| Molecular Formula | C16H15F2N3O2 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | (3R)-N-(1-cyanocyclobutyl)-1-(3,4-difluorophenyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | N#CC1(NC(=O)[C@H]2CCN(c3ccc(F)c(F)c3)C2=O)CCC1 |
| InChI | InChI=1S/C16H15F2N3O2/c17-12-3-2-10(8-13(12)18)21-7-4-11(15(21)23)14(22)20-16(9-19)5-1-6-16/h2-3,8,11H,1,4-7H2,(H,20,22)/t11-/m1/s1 |
| InChIKey | VIZOJTAJUWKUJS-LLVKDONJSA-N |
| XLogP | 1.88 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|