C24H22FN5O3 — CID 42853839
N-(1-benzoylpiperidin-4-yl)-3-[(4-fluorobenzoyl)amino]pyrazine-2-carboxamide (PubChem CID 42853839) has the molecular formula C24H22FN5O3 and a molecular weight of 447.47 g/mol. Its IUPAC name is N-(1-benzoylpiperidin-4-yl)-3-[(4-fluorobenzoyl)amino]pyrazine-2-carboxamide.
| Compound Name | N-(1-benzoylpiperidin-4-yl)-3-[(4-fluorobenzoyl)amino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 42853839 |
| Molecular Formula | C24H22FN5O3 |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | N-(1-benzoylpiperidin-4-yl)-3-[(4-fluorobenzoyl)amino]pyrazine-2-carboxamide |
| SMILES | O=C(Nc1nccnc1C(=O)NC1CCN(C(=O)c2ccccc2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H22FN5O3/c25-18-8-6-16(7-9-18)22(31)29-21-20(26-12-13-27-21)23(32)28-19-10-14-30(15-11-19)24(33)17-4-2-1-3-5-17/h1-9,12-13,19H,10-11,14-15H2,(H,28,32)(H,27,29,31) |
| InChIKey | KHVUPCSZPFYJIG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |