C24H23N5O3 — CID 90488210
3-benzamido-N-(1-benzoylpiperidin-4-yl)pyrazine-2-carboxamide (PubChem CID 90488210) has the molecular formula C24H23N5O3 and a molecular weight of 429.48 g/mol. Its IUPAC name is 3-benzamido-N-(1-benzoylpiperidin-4-yl)pyrazine-2-carboxamide.
| Compound Name | 3-benzamido-N-(1-benzoylpiperidin-4-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 90488210 |
| Molecular Formula | C24H23N5O3 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 3-benzamido-N-(1-benzoylpiperidin-4-yl)pyrazine-2-carboxamide |
| SMILES | O=C(Nc1nccnc1C(=O)NC1CCN(C(=O)c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C24H23N5O3/c30-22(17-7-3-1-4-8-17)28-21-20(25-13-14-26-21)23(31)27-19-11-15-29(16-12-19)24(32)18-9-5-2-6-10-18/h1-10,13-14,19H,11-12,15-16H2,(H,27,31)(H,26,28,30) |
| InChIKey | WKRJRJVUAGORFI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |