C26H27N5O3 — CID 42853891
3-[(4-methylbenzoyl)amino]-N-[1-(2-phenylacetyl)piperidin-4-yl]pyrazine-2-carboxamide (PubChem CID 42853891) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is 3-[(4-methylbenzoyl)amino]-N-[1-(2-phenylacetyl)piperidin-4-yl]pyrazine-2-carboxamide.
| Compound Name | 3-[(4-methylbenzoyl)amino]-N-[1-(2-phenylacetyl)piperidin-4-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 42853891 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 3-[(4-methylbenzoyl)amino]-N-[1-(2-phenylacetyl)piperidin-4-yl]pyrazine-2-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2nccnc2C(=O)NC2CCN(C(=O)Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H27N5O3/c1-18-7-9-20(10-8-18)25(33)30-24-23(27-13-14-28-24)26(34)29-21-11-15-31(16-12-21)22(32)17-19-5-3-2-4-6-19/h2-10,13-14,21H,11-12,15-17H2,1H3,(H,29,34)(H,28,30,33) |
| InChIKey | KRSQCEDBHHYMHX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |