C16H12ClFN4O — CID 42864299
N'-(2-chloro-6-methylquinazolin-4-yl)-2-fluorobenzohydrazide (PubChem CID 42864299) has the molecular formula C16H12ClFN4O and a molecular weight of 330.75 g/mol. Its IUPAC name is N'-(2-chloro-6-methylquinazolin-4-yl)-2-fluorobenzohydrazide.
| Compound Name | N'-(2-chloro-6-methylquinazolin-4-yl)-2-fluorobenzohydrazide |
|---|---|
| PubChem CID | 42864299 |
| Molecular Formula | C16H12ClFN4O |
| Molecular Weight | 330.75 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | N'-(2-chloro-6-methylquinazolin-4-yl)-2-fluorobenzohydrazide |
| SMILES | Cc1ccc2nc(Cl)nc(NNC(=O)c3ccccc3F)c2c1 |
| InChI | InChI=1S/C16H12ClFN4O/c1-9-6-7-13-11(8-9)14(20-16(17)19-13)21-22-15(23)10-4-2-3-5-12(10)18/h2-8H,1H3,(H,22,23)(H,19,20,21) |
| InChIKey | KWEAYEPVBRESBU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.75 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|