C19H19FN6 — CID 42864529
N'-[3-(2-fluorophenyl)-9-methyl-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]-N-methylethane-1,2-diamine (PubChem CID 42864529) has the molecular formula C19H19FN6 and a molecular weight of 350.40 g/mol. Its IUPAC name is N'-[3-(2-fluorophenyl)-9-methyl-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]-N-methylethane-1,2-diamine.
| Compound Name | N'-[3-(2-fluorophenyl)-9-methyl-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 42864529 |
| Molecular Formula | C19H19FN6 |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | N'-[3-(2-fluorophenyl)-9-methyl-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]-N-methylethane-1,2-diamine |
| SMILES | CNCCNc1nc2ccc(C)cc2c2nnc(-c3ccccc3F)n12 |
| InChI | InChI=1S/C19H19FN6/c1-12-7-8-16-14(11-12)18-25-24-17(13-5-3-4-6-15(13)20)26(18)19(23-16)22-10-9-21-2/h3-8,11,21H,9-10H2,1-2H3,(H,22,23) |
| InChIKey | KCAGRNFVINSCGN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 67.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|