C22H22N2O5S — CID 42866897
N-(2,4-dimethoxyphenyl)-2-(3-methoxy-4-prop-2-enoxyphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 42866897) has the molecular formula C22H22N2O5S and a molecular weight of 426.49 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-(3-methoxy-4-prop-2-enoxyphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-(3-methoxy-4-prop-2-enoxyphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 42866897 |
| Molecular Formula | C22H22N2O5S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-(3-methoxy-4-prop-2-enoxyphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | C=CCOc1ccc(-c2nc(C(=O)Nc3ccc(OC)cc3OC)cs2)cc1OC |
| InChI | InChI=1S/C22H22N2O5S/c1-5-10-29-18-9-6-14(11-20(18)28-4)22-24-17(13-30-22)21(25)23-16-8-7-15(26-2)12-19(16)27-3/h5-9,11-13H,1,10H2,2-4H3,(H,23,25) |
| InChIKey | MHAUQTQFWUEPAS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|