C24H27N3O4 — CID 42879541
N-[3-amino-4-(2-methoxyphenyl)-1-oxo-2-(oxolan-2-ylmethyl)isoquinolin-7-yl]propanamide (PubChem CID 42879541) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is N-[3-amino-4-(2-methoxyphenyl)-1-oxo-2-(oxolan-2-ylmethyl)isoquinolin-7-yl]propanamide.
| Compound Name | N-[3-amino-4-(2-methoxyphenyl)-1-oxo-2-(oxolan-2-ylmethyl)isoquinolin-7-yl]propanamide |
|---|---|
| PubChem CID | 42879541 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N-[3-amino-4-(2-methoxyphenyl)-1-oxo-2-(oxolan-2-ylmethyl)isoquinolin-7-yl]propanamide |
| SMILES | CCC(=O)Nc1ccc2c(-c3ccccc3OC)c(N)n(CC3CCCO3)c(=O)c2c1 |
| InChI | InChI=1S/C24H27N3O4/c1-3-21(28)26-15-10-11-17-19(13-15)24(29)27(14-16-7-6-12-31-16)23(25)22(17)18-8-4-5-9-20(18)30-2/h4-5,8-11,13,16H,3,6-7,12,14,25H2,1-2H3,(H,26,28) |
| InChIKey | ADKABUZFOYRCFY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |