C27H25FN4O3 — CID 42879558
1-[3-amino-4-(3-fluorophenyl)-1-oxo-2-(oxolan-2-ylmethyl)isoquinolin-7-yl]-3-phenylurea (PubChem CID 42879558) has the molecular formula C27H25FN4O3 and a molecular weight of 472.52 g/mol. Its IUPAC name is 1-[3-amino-4-(3-fluorophenyl)-1-oxo-2-(oxolan-2-ylmethyl)isoquinolin-7-yl]-3-phenylurea.
| Compound Name | 1-[3-amino-4-(3-fluorophenyl)-1-oxo-2-(oxolan-2-ylmethyl)isoquinolin-7-yl]-3-phenylurea |
|---|---|
| PubChem CID | 42879558 |
| Molecular Formula | C27H25FN4O3 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 1-[3-amino-4-(3-fluorophenyl)-1-oxo-2-(oxolan-2-ylmethyl)isoquinolin-7-yl]-3-phenylurea |
| SMILES | Nc1c(-c2cccc(F)c2)c2ccc(NC(=O)Nc3ccccc3)cc2c(=O)n1CC1CCCO1 |
| InChI | InChI=1S/C27H25FN4O3/c28-18-7-4-6-17(14-18)24-22-12-11-20(31-27(34)30-19-8-2-1-3-9-19)15-23(22)26(33)32(25(24)29)16-21-10-5-13-35-21/h1-4,6-9,11-12,14-15,21H,5,10,13,16,29H2,(H2,30,31,34) |
| InChIKey | IMAUPHNQWLJINO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |