C27H26FN3O3 — CID 42882447
4-benzyl-2-(4-fluorophenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]furo[3,2-b]pyrrole-5-carboxamide (PubChem CID 42882447) has the molecular formula C27H26FN3O3 and a molecular weight of 459.52 g/mol. Its IUPAC name is 4-benzyl-2-(4-fluorophenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]furo[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 4-benzyl-2-(4-fluorophenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]furo[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 42882447 |
| Molecular Formula | C27H26FN3O3 |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 4-benzyl-2-(4-fluorophenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]furo[3,2-b]pyrrole-5-carboxamide |
| SMILES | O=C(NCCCN1CCCC1=O)c1cc2oc(-c3ccc(F)cc3)cc2n1Cc1ccccc1 |
| InChI | InChI=1S/C27H26FN3O3/c28-21-11-9-20(10-12-21)24-16-22-25(34-24)17-23(31(22)18-19-6-2-1-3-7-19)27(33)29-13-5-15-30-14-4-8-26(30)32/h1-3,6-7,9-12,16-17H,4-5,8,13-15,18H2,(H,29,33) |
| InChIKey | UFPSNARQAMHAOU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|