C24H25N5O2 — CID 42883560
methyl 2-cyano-2-[3-[(2-phenyl-2-pyrrolidin-1-ylethyl)amino]quinoxalin-2-yl]acetate (PubChem CID 42883560) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is methyl 2-cyano-2-[3-[(2-phenyl-2-pyrrolidin-1-ylethyl)amino]quinoxalin-2-yl]acetate.
| Compound Name | methyl 2-cyano-2-[3-[(2-phenyl-2-pyrrolidin-1-ylethyl)amino]quinoxalin-2-yl]acetate |
|---|---|
| PubChem CID | 42883560 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | methyl 2-cyano-2-[3-[(2-phenyl-2-pyrrolidin-1-ylethyl)amino]quinoxalin-2-yl]acetate |
| SMILES | COC(=O)C(C#N)c1nc2ccccc2nc1NCC(c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C24H25N5O2/c1-31-24(30)18(15-25)22-23(28-20-12-6-5-11-19(20)27-22)26-16-21(29-13-7-8-14-29)17-9-3-2-4-10-17/h2-6,9-12,18,21H,7-8,13-14,16H2,1H3,(H,26,28) |
| InChIKey | WJLGAZPTRLUQMF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |