C22H29N5O4 — CID 42959187
methyl 2-cyano-2-[3-[3-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylamino]quinoxalin-2-yl]acetate (PubChem CID 42959187) has the molecular formula C22H29N5O4 and a molecular weight of 427.51 g/mol. Its IUPAC name is methyl 2-cyano-2-[3-[3-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylamino]quinoxalin-2-yl]acetate.
| Compound Name | methyl 2-cyano-2-[3-[3-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylamino]quinoxalin-2-yl]acetate |
|---|---|
| PubChem CID | 42959187 |
| Molecular Formula | C22H29N5O4 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | methyl 2-cyano-2-[3-[3-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylamino]quinoxalin-2-yl]acetate |
| SMILES | CCN(CCCNc1nc2ccccc2nc1C(C#N)C(=O)OC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H29N5O4/c1-6-27(21(29)31-22(2,3)4)13-9-12-24-19-18(15(14-23)20(28)30-5)25-16-10-7-8-11-17(16)26-19/h7-8,10-11,15H,6,9,12-13H2,1-5H3,(H,24,26) |
| InChIKey | OZKABBGUTADYDG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|