C21H19FN2O3 — CID 42895795
[2-(dimethylamino)-2-oxo-1-phenylethyl] 7-fluoro-2-methylquinoline-3-carboxylate (PubChem CID 42895795) has the molecular formula C21H19FN2O3 and a molecular weight of 366.39 g/mol. Its IUPAC name is [2-(dimethylamino)-2-oxo-1-phenylethyl] 7-fluoro-2-methylquinoline-3-carboxylate.
| Compound Name | [2-(dimethylamino)-2-oxo-1-phenylethyl] 7-fluoro-2-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 42895795 |
| Molecular Formula | C21H19FN2O3 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | [2-(dimethylamino)-2-oxo-1-phenylethyl] 7-fluoro-2-methylquinoline-3-carboxylate |
| SMILES | Cc1nc2cc(F)ccc2cc1C(=O)OC(C(=O)N(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H19FN2O3/c1-13-17(11-15-9-10-16(22)12-18(15)23-13)21(26)27-19(20(25)24(2)3)14-7-5-4-6-8-14/h4-12,19H,1-3H3 |
| InChIKey | XTDCJOGBUIZMEV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |