About N-(4-thiophen-2-yl-1,3-thiazol-2-yl)-2,3-dihydro-1-benzothiophene-2-carboxamide
N-(4-thiophen-2-yl-1,3-thiazol-2-yl)-2,3-dihydro-1-benzothiophene-2-carboxamide (PubChem CID 42896496) has the molecular formula C16H12N2OS3
and a molecular weight of 344.49 g/mol. Its IUPAC name is N-(4-thiophen-2-yl-1,3-thiazol-2-yl)-2,3-dihydro-1-benzothiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-(4-thiophen-2-yl-1,3-thiazol-2-yl)-2,3-dihydro-1-benzothiophene-2-carboxamide |
| PubChem CID | 42896496 |
| Molecular Formula | C16H12N2OS3 |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | N-(4-thiophen-2-yl-1,3-thiazol-2-yl)-2,3-dihydro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1nc(-c2cccs2)cs1)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C16H12N2OS3/c19-15(14-8-10-4-1-2-5-12(10)22-14)18-16-17-11(9-21-16)13-6-3-7-20-13/h1-7,9,14H,8H2,(H,17,18,19) |
| InChIKey | ARDADRGMJIXEIA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-thiophen-2-yl-1,3-thiazol-2-yl)-2,3-dihydro-1-benzothiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-thiophen-2-yl-1,3-thiazol-2-yl)-2,3-dihydro-1-benzothiophene-2-carboxamide?
The IUPAC name of N-(4-thiophen-2-yl-1,3-thiazol-2-yl)-2,3-dihydro-1-benzothiophene-2-carboxamide (CID 42896496) is N-(4-thiophen-2-yl-1,3-thiazol-2-yl)-2,3-dihydro-1-benzothiophene-2-carboxamide.
What is the SMILES notation for N-(4-thiophen-2-yl-1,3-thiazol-2-yl)-2,3-dihydro-1-benzothiophene-2-carboxamide?
The canonical SMILES for N-(4-thiophen-2-yl-1,3-thiazol-2-yl)-2,3-dihydro-1-benzothiophene-2-carboxamide is O=C(Nc1nc(-c2cccs2)cs1)C1Cc2ccccc2S1.
What is the InChIKey of N-(4-thiophen-2-yl-1,3-thiazol-2-yl)-2,3-dihydro-1-benzothiophene-2-carboxamide?
The InChIKey is ARDADRGMJIXEIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2OS3/c19-15(14-8-10-4-1-2-5-12(10)22-14)18-16-17-11(9-21-16)13-6-3-7-20-13/h1-7,9,14H,8H2,(H,17,18,19).
What are the key properties of N-(4-thiophen-2-yl-1,3-thiazol-2-yl)-2,3-dihydro-1-benzothiophene-2-carboxamide?
N-(4-thiophen-2-yl-1,3-thiazol-2-yl)-2,3-dihydro-1-benzothiophene-2-carboxamide has a molecular weight of 344.49 g/mol, XLogP of 4.53, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-thiophen-2-yl-1,3-thiazol-2-yl)-2,3-dihydro-1-benzothiophene-2-carboxamide is sourced from PubChem (CID 42896496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).