C15H21N3O5 — CID 42902059
1-O-ethyl 4-O-[1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] (E)-but-2-enedioate (PubChem CID 42902059) has the molecular formula C15H21N3O5 and a molecular weight of 323.35 g/mol. Its IUPAC name is 1-O-ethyl 4-O-[1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] (E)-but-2-enedioate.
| Compound Name | 1-O-ethyl 4-O-[1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 42902059 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 1-O-ethyl 4-O-[1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] (E)-but-2-enedioate |
| SMILES | CCOC(=O)/C=C/C(=O)OC(C)C(=O)Nc1ccnn1C(C)C |
| InChI | InChI=1S/C15H21N3O5/c1-5-22-13(19)6-7-14(20)23-11(4)15(21)17-12-8-9-16-18(12)10(2)3/h6-11H,5H2,1-4H3,(H,17,21)/b7-6+ |
| InChIKey | DJNPBXDZVQGOHX-VOTSOKGWSA-N |
| XLogP | 1.45 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|