C18H18N4O3S — CID 42908925
N'-[1-(3-methylsulfanylphenyl)-5-oxopyrrolidine-3-carbonyl]pyridine-3-carbohydrazide (PubChem CID 42908925) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is N'-[1-(3-methylsulfanylphenyl)-5-oxopyrrolidine-3-carbonyl]pyridine-3-carbohydrazide.
| Compound Name | N'-[1-(3-methylsulfanylphenyl)-5-oxopyrrolidine-3-carbonyl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 42908925 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N'-[1-(3-methylsulfanylphenyl)-5-oxopyrrolidine-3-carbonyl]pyridine-3-carbohydrazide |
| SMILES | CSc1cccc(N2CC(C(=O)NNC(=O)c3cccnc3)CC2=O)c1 |
| InChI | InChI=1S/C18H18N4O3S/c1-26-15-6-2-5-14(9-15)22-11-13(8-16(22)23)18(25)21-20-17(24)12-4-3-7-19-10-12/h2-7,9-10,13H,8,11H2,1H3,(H,20,24)(H,21,25) |
| InChIKey | ZAJMJJXCSABFRX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|