C19H22F2N4O4S — CID 42909458
N-[1-(2,4-difluorophenyl)ethyl]-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroaniline (PubChem CID 42909458) has the molecular formula C19H22F2N4O4S and a molecular weight of 440.47 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenyl)ethyl]-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroaniline.
| Compound Name | N-[1-(2,4-difluorophenyl)ethyl]-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 42909458 |
| Molecular Formula | C19H22F2N4O4S |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | N-[1-(2,4-difluorophenyl)ethyl]-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroaniline |
| SMILES | CC(Nc1ccc(S(=O)(=O)N2CCN(C)CC2)cc1[N+](=O)[O-])c1ccc(F)cc1F |
| InChI | InChI=1S/C19H22F2N4O4S/c1-13(16-5-3-14(20)11-17(16)21)22-18-6-4-15(12-19(18)25(26)27)30(28,29)24-9-7-23(2)8-10-24/h3-6,11-13,22H,7-10H2,1-2H3 |
| InChIKey | ZVKAMZVFRQCFQP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|