C23H30N4O6S — CID 41260522
N-[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroaniline (PubChem CID 41260522) has the molecular formula C23H30N4O6S and a molecular weight of 490.58 g/mol. Its IUPAC name is N-[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroaniline.
| Compound Name | N-[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 41260522 |
| Molecular Formula | C23H30N4O6S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | N-[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroaniline |
| SMILES | CC(C)[C@@H](Nc1ccc(S(=O)(=O)N2CCN(C)CC2)cc1[N+](=O)[O-])c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C23H30N4O6S/c1-16(2)23(17-4-7-21-22(14-17)33-13-12-32-21)24-19-6-5-18(15-20(19)27(28)29)34(30,31)26-10-8-25(3)9-11-26/h4-7,14-16,23-24H,8-13H2,1-3H3/t23-/m1/s1 |
| InChIKey | XYQAASMBCYOOQH-HSZRJFAPSA-N |
| XLogP | 3.11 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|