C20H21N3O4 — CID 8009476
2-[[(1S)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]amino]-5-nitrobenzonitrile (PubChem CID 8009476) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 2-[[(1S)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]amino]-5-nitrobenzonitrile.
| Compound Name | 2-[[(1S)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]amino]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 8009476 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-[[(1S)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]amino]-5-nitrobenzonitrile |
| SMILES | CC(C)[C@H](Nc1ccc([N+](=O)[O-])cc1C#N)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C20H21N3O4/c1-13(2)20(14-4-7-18-19(11-14)27-9-3-8-26-18)22-17-6-5-16(23(24)25)10-15(17)12-21/h4-7,10-11,13,20,22H,3,8-9H2,1-2H3/t20-/m0/s1 |
| InChIKey | ZFFCZHRXVWFILX-FQEVSTJZSA-N |
| XLogP | 4.44 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|