C19H20N4O4 — CID 45351654
2-[[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]amino]-5-nitropyridine-3-carbonitrile (PubChem CID 45351654) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 2-[[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]amino]-5-nitropyridine-3-carbonitrile.
| Compound Name | 2-[[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]amino]-5-nitropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 45351654 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 2-[[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]amino]-5-nitropyridine-3-carbonitrile |
| SMILES | CC(C)C(Nc1ncc([N+](=O)[O-])cc1C#N)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C19H20N4O4/c1-12(2)18(13-4-5-16-17(9-13)27-7-3-6-26-16)22-19-14(10-20)8-15(11-21-19)23(24)25/h4-5,8-9,11-12,18H,3,6-7H2,1-2H3,(H,21,22) |
| InChIKey | RQTPLNPFLBSZPW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 110.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|