C22H29N3O5S — CID 42912854
[1-(2-ethylpiperidin-1-yl)-1-oxopropan-2-yl] 2-[(4-methyl-2,5-dioxoimidazolidin-4-yl)methylsulfanyl]benzoate (PubChem CID 42912854) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is [1-(2-ethylpiperidin-1-yl)-1-oxopropan-2-yl] 2-[(4-methyl-2,5-dioxoimidazolidin-4-yl)methylsulfanyl]benzoate.
| Compound Name | [1-(2-ethylpiperidin-1-yl)-1-oxopropan-2-yl] 2-[(4-methyl-2,5-dioxoimidazolidin-4-yl)methylsulfanyl]benzoate |
|---|---|
| PubChem CID | 42912854 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | [1-(2-ethylpiperidin-1-yl)-1-oxopropan-2-yl] 2-[(4-methyl-2,5-dioxoimidazolidin-4-yl)methylsulfanyl]benzoate |
| SMILES | CCC1CCCCN1C(=O)C(C)OC(=O)c1ccccc1SCC1(C)NC(=O)NC1=O |
| InChI | InChI=1S/C22H29N3O5S/c1-4-15-9-7-8-12-25(15)18(26)14(2)30-19(27)16-10-5-6-11-17(16)31-13-22(3)20(28)23-21(29)24-22/h5-6,10-11,14-15H,4,7-9,12-13H2,1-3H3,(H2,23,24,28,29) |
| InChIKey | JRRREXFUOOYERK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|