C20H19N3O5S — CID 8506602
(2-anilino-2-oxoethyl) 2-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]benzoate (PubChem CID 8506602) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 2-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]benzoate.
| Compound Name | (2-anilino-2-oxoethyl) 2-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]benzoate |
|---|---|
| PubChem CID | 8506602 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | (2-anilino-2-oxoethyl) 2-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]benzoate |
| SMILES | C[C@]1(CSc2ccccc2C(=O)OCC(=O)Nc2ccccc2)NC(=O)NC1=O |
| InChI | InChI=1S/C20H19N3O5S/c1-20(18(26)22-19(27)23-20)12-29-15-10-6-5-9-14(15)17(25)28-11-16(24)21-13-7-3-2-4-8-13/h2-10H,11-12H2,1H3,(H,21,24)(H2,22,23,26,27)/t20-/m1/s1 |
| InChIKey | ZPNWZRLHTDWBQV-HXUWFJFHSA-N |
| XLogP | 2.17 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|