C20H20N2O4S — CID 9358085
[(1S)-1-phenylethyl] 2-[[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]benzoate (PubChem CID 9358085) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is [(1S)-1-phenylethyl] 2-[[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]benzoate.
| Compound Name | [(1S)-1-phenylethyl] 2-[[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]benzoate |
|---|---|
| PubChem CID | 9358085 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | [(1S)-1-phenylethyl] 2-[[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]benzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1SC[C@]1(C)NC(=O)NC1=O)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O4S/c1-13(14-8-4-3-5-9-14)26-17(23)15-10-6-7-11-16(15)27-12-20(2)18(24)21-19(25)22-20/h3-11,13H,12H2,1-2H3,(H2,21,22,24,25)/t13-,20-/m0/s1 |
| InChIKey | GCWPOEUGCOEPNT-RBZFPXEDSA-N |
| XLogP | 3.29 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|