C20H18N4O4S — CID 9490441
N-(2-methyl-1,3-benzoxazol-5-yl)-2-[[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]benzamide (PubChem CID 9490441) has the molecular formula C20H18N4O4S and a molecular weight of 410.46 g/mol. Its IUPAC name is N-(2-methyl-1,3-benzoxazol-5-yl)-2-[[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]benzamide.
| Compound Name | N-(2-methyl-1,3-benzoxazol-5-yl)-2-[[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]benzamide |
|---|---|
| PubChem CID | 9490441 |
| Molecular Formula | C20H18N4O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | N-(2-methyl-1,3-benzoxazol-5-yl)-2-[[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]benzamide |
| SMILES | Cc1nc2cc(NC(=O)c3ccccc3SC[C@]3(C)NC(=O)NC3=O)ccc2o1 |
| InChI | InChI=1S/C20H18N4O4S/c1-11-21-14-9-12(7-8-15(14)28-11)22-17(25)13-5-3-4-6-16(13)29-10-20(2)18(26)23-19(27)24-20/h3-9H,10H2,1-2H3,(H,22,25)(H2,23,24,26,27)/t20-/m0/s1 |
| InChIKey | BBMIBRHQQBKBRV-FQEVSTJZSA-N |
| XLogP | 3.08 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|