C20H19BrN2O5S — CID 4786068
2-(3-bromophenoxy)ethyl 2-[(4-methyl-2,5-dioxoimidazolidin-4-yl)methylsulfanyl]benzoate (PubChem CID 4786068) has the molecular formula C20H19BrN2O5S and a molecular weight of 479.35 g/mol. Its IUPAC name is 2-(3-bromophenoxy)ethyl 2-[(4-methyl-2,5-dioxoimidazolidin-4-yl)methylsulfanyl]benzoate.
| Compound Name | 2-(3-bromophenoxy)ethyl 2-[(4-methyl-2,5-dioxoimidazolidin-4-yl)methylsulfanyl]benzoate |
|---|---|
| PubChem CID | 4786068 |
| Molecular Formula | C20H19BrN2O5S |
| Molecular Weight | 479.35 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | 2-(3-bromophenoxy)ethyl 2-[(4-methyl-2,5-dioxoimidazolidin-4-yl)methylsulfanyl]benzoate |
| SMILES | CC1(CSc2ccccc2C(=O)OCCOc2cccc(Br)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C20H19BrN2O5S/c1-20(18(25)22-19(26)23-20)12-29-16-8-3-2-7-15(16)17(24)28-10-9-27-14-6-4-5-13(21)11-14/h2-8,11H,9-10,12H2,1H3,(H2,22,23,25,26) |
| InChIKey | XRDWXMPYUIITJY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|