C25H29N5O4S — CID 42915515
2-[(2',5'-dioxospiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,4'-imidazolidine]-1'-yl)methyl]-1-ethyl-N,N-dimethylbenzimidazole-5-sulfonamide (PubChem CID 42915515) has the molecular formula C25H29N5O4S and a molecular weight of 495.61 g/mol. Its IUPAC name is 2-[(2',5'-dioxospiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,4'-imidazolidine]-1'-yl)methyl]-1-ethyl-N,N-dimethylbenzimidazole-5-sulfonamide.
| Compound Name | 2-[(2',5'-dioxospiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,4'-imidazolidine]-1'-yl)methyl]-1-ethyl-N,N-dimethylbenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 42915515 |
| Molecular Formula | C25H29N5O4S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 2-[(2',5'-dioxospiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,4'-imidazolidine]-1'-yl)methyl]-1-ethyl-N,N-dimethylbenzimidazole-5-sulfonamide |
| SMILES | CCn1c(CN2C(=O)NC3(CCCCc4ccccc43)C2=O)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C25H29N5O4S/c1-4-29-21-13-12-18(35(33,34)28(2)3)15-20(21)26-22(29)16-30-23(31)25(27-24(30)32)14-8-7-10-17-9-5-6-11-19(17)25/h5-6,9,11-13,15H,4,7-8,10,14,16H2,1-3H3,(H,27,32) |
| InChIKey | GTSOIKJLMHMZEN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|