C20H21FN2O3 — CID 42921740
(E)-N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methyl-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide (PubChem CID 42921740) has the molecular formula C20H21FN2O3 and a molecular weight of 356.40 g/mol. Its IUPAC name is (E)-N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methyl-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methyl-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 42921740 |
| Molecular Formula | C20H21FN2O3 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (E)-N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methyl-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide |
| SMILES | CC1CC1c1ccc(/C=C/C(=O)N(C)CC(=O)Nc2cccc(F)c2)o1 |
| InChI | InChI=1S/C20H21FN2O3/c1-13-10-17(13)18-8-6-16(26-18)7-9-20(25)23(2)12-19(24)22-15-5-3-4-14(21)11-15/h3-9,11,13,17H,10,12H2,1-2H3,(H,22,24)/b9-7+ |
| InChIKey | GXXNPYFLEBYCFA-VQHVLOKHSA-N |
| XLogP | 3.65 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|