C25H20N2O5S — CID 42922420
(4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 3-(4,7-dimethyl-2-oxochromen-3-yl)propanoate (PubChem CID 42922420) has the molecular formula C25H20N2O5S and a molecular weight of 460.51 g/mol. Its IUPAC name is (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 3-(4,7-dimethyl-2-oxochromen-3-yl)propanoate.
| Compound Name | (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 3-(4,7-dimethyl-2-oxochromen-3-yl)propanoate |
|---|---|
| PubChem CID | 42922420 |
| Molecular Formula | C25H20N2O5S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | (4-oxopyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 3-(4,7-dimethyl-2-oxochromen-3-yl)propanoate |
| SMILES | Cc1ccc2c(C)c(CCC(=O)OCc3cc(=O)n4c(n3)sc3ccccc34)c(=O)oc2c1 |
| InChI | InChI=1S/C25H20N2O5S/c1-14-7-8-17-15(2)18(24(30)32-20(17)11-14)9-10-23(29)31-13-16-12-22(28)27-19-5-3-4-6-21(19)33-25(27)26-16/h3-8,11-12H,9-10,13H2,1-2H3 |
| InChIKey | SKZGMBUATGJIKY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 90.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|