C16H19N3O3 — CID 42923822
N-(5-methyl-1,2-oxazol-3-yl)-2-[(E)-(2-methylphenyl)methylideneamino]oxybutanamide (PubChem CID 42923822) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-3-yl)-2-[(E)-(2-methylphenyl)methylideneamino]oxybutanamide.
| Compound Name | N-(5-methyl-1,2-oxazol-3-yl)-2-[(E)-(2-methylphenyl)methylideneamino]oxybutanamide |
|---|---|
| PubChem CID | 42923822 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-3-yl)-2-[(E)-(2-methylphenyl)methylideneamino]oxybutanamide |
| SMILES | CCC(O/N=C/c1ccccc1C)C(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C16H19N3O3/c1-4-14(16(20)18-15-9-12(3)21-19-15)22-17-10-13-8-6-5-7-11(13)2/h5-10,14H,4H2,1-3H3,(H,18,19,20)/b17-10+ |
| InChIKey | MBJWUMPVSNMKNM-LICLKQGHSA-N |
| XLogP | 3.06 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|