C24H22N2O6 — CID 42925743
1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoate (PubChem CID 42925743) has the molecular formula C24H22N2O6 and a molecular weight of 434.45 g/mol. Its IUPAC name is 1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoate.
| Compound Name | 1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoate |
|---|---|
| PubChem CID | 42925743 |
| Molecular Formula | C24H22N2O6 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoate |
| SMILES | COc1ccc2c(C)c(CCC(=O)OC(C)c3nnc(-c4ccccc4)o3)c(=O)oc2c1 |
| InChI | InChI=1S/C24H22N2O6/c1-14-18-10-9-17(29-3)13-20(18)31-24(28)19(14)11-12-21(27)30-15(2)22-25-26-23(32-22)16-7-5-4-6-8-16/h4-10,13,15H,11-12H2,1-3H3 |
| InChIKey | GFUXMBZCLICOGR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 104.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|