C23H24F2N4O4 — CID 42926185
6-amino-5-[2-[3-benzyl-4-(difluoromethoxy)anilino]propanoyl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 42926185) has the molecular formula C23H24F2N4O4 and a molecular weight of 458.47 g/mol. Its IUPAC name is 6-amino-5-[2-[3-benzyl-4-(difluoromethoxy)anilino]propanoyl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-amino-5-[2-[3-benzyl-4-(difluoromethoxy)anilino]propanoyl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 42926185 |
| Molecular Formula | C23H24F2N4O4 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 6-amino-5-[2-[3-benzyl-4-(difluoromethoxy)anilino]propanoyl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | CC(Nc1ccc(OC(F)F)c(Cc2ccccc2)c1)C(=O)c1c(N)n(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C23H24F2N4O4/c1-13(19(30)18-20(26)28(2)23(32)29(3)21(18)31)27-16-9-10-17(33-22(24)25)15(12-16)11-14-7-5-4-6-8-14/h4-10,12-13,22,27H,11,26H2,1-3H3 |
| InChIKey | ZLJATWLVOIBZNE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|