C24H29F3N2O2 — CID 42927404
2-[4-[2-(4-methoxyphenyl)ethyl]piperidin-1-yl]-N-[2-(trifluoromethyl)phenyl]propanamide (PubChem CID 42927404) has the molecular formula C24H29F3N2O2 and a molecular weight of 434.50 g/mol. Its IUPAC name is 2-[4-[2-(4-methoxyphenyl)ethyl]piperidin-1-yl]-N-[2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-[4-[2-(4-methoxyphenyl)ethyl]piperidin-1-yl]-N-[2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 42927404 |
| Molecular Formula | C24H29F3N2O2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 2-[4-[2-(4-methoxyphenyl)ethyl]piperidin-1-yl]-N-[2-(trifluoromethyl)phenyl]propanamide |
| SMILES | COc1ccc(CCC2CCN(C(C)C(=O)Nc3ccccc3C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C24H29F3N2O2/c1-17(23(30)28-22-6-4-3-5-21(22)24(25,26)27)29-15-13-19(14-16-29)8-7-18-9-11-20(31-2)12-10-18/h3-6,9-12,17,19H,7-8,13-16H2,1-2H3,(H,28,30) |
| InChIKey | FOMWAYZJPFJMOI-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |