C21H20F2N2O5 — CID 42928873
[1-(3,4-difluorophenyl)-1-oxopropan-2-yl] 1-(2-nitrophenyl)piperidine-4-carboxylate (PubChem CID 42928873) has the molecular formula C21H20F2N2O5 and a molecular weight of 418.40 g/mol. Its IUPAC name is [1-(3,4-difluorophenyl)-1-oxopropan-2-yl] 1-(2-nitrophenyl)piperidine-4-carboxylate.
| Compound Name | [1-(3,4-difluorophenyl)-1-oxopropan-2-yl] 1-(2-nitrophenyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 42928873 |
| Molecular Formula | C21H20F2N2O5 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | [1-(3,4-difluorophenyl)-1-oxopropan-2-yl] 1-(2-nitrophenyl)piperidine-4-carboxylate |
| SMILES | CC(OC(=O)C1CCN(c2ccccc2[N+](=O)[O-])CC1)C(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H20F2N2O5/c1-13(20(26)15-6-7-16(22)17(23)12-15)30-21(27)14-8-10-24(11-9-14)18-4-2-3-5-19(18)25(28)29/h2-7,12-14H,8-11H2,1H3 |
| InChIKey | IEXKNSGNYXEVLS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|