C23H26N6O2 — CID 42931764
4-[3-[4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-2-hydroxypropoxy]benzonitrile (PubChem CID 42931764) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 4-[3-[4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-2-hydroxypropoxy]benzonitrile.
| Compound Name | 4-[3-[4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-2-hydroxypropoxy]benzonitrile |
|---|---|
| PubChem CID | 42931764 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 4-[3-[4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-2-hydroxypropoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCC(O)CN2CCN(Cc3nc(N)c4ccccc4n3)CC2)cc1 |
| InChI | InChI=1S/C23H26N6O2/c24-13-17-5-7-19(8-6-17)31-16-18(30)14-28-9-11-29(12-10-28)15-22-26-21-4-2-1-3-20(21)23(25)27-22/h1-8,18,30H,9-12,14-16H2,(H2,25,26,27) |
| InChIKey | VLFHWRZEZAGPPI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |