C22H24N6O — CID 87015487
3-[2-[4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]ethoxy]benzonitrile (PubChem CID 87015487) has the molecular formula C22H24N6O and a molecular weight of 388.48 g/mol. Its IUPAC name is 3-[2-[4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]ethoxy]benzonitrile.
| Compound Name | 3-[2-[4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 87015487 |
| Molecular Formula | C22H24N6O |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 3-[2-[4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]ethoxy]benzonitrile |
| SMILES | N#Cc1cccc(OCCN2CCN(Cc3nc(N)c4ccccc4n3)CC2)c1 |
| InChI | InChI=1S/C22H24N6O/c23-15-17-4-3-5-18(14-17)29-13-12-27-8-10-28(11-9-27)16-21-25-20-7-2-1-6-19(20)22(24)26-21/h1-7,14H,8-13,16H2,(H2,24,25,26) |
| InChIKey | JCEUUKPUYPUONA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |